CAS 144038-79-9 is the registry number for N-(3-Cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)acetamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)acetamide (CAS 144038-79-9) is a chemical compound with the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. IUPAC name: N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)acetamide. InChIKey: SVVQBULYYMXCDX-UHFFFAOYSA-N.
| Molecular formula | C10H10N2OS |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)acetamide |
| InChIKey | SVVQBULYYMXCDX-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C2=C(S1)CCC2)C#N |
Computed by PubChem (NCBI)