CAS 1441417-34-0 is the registry number for Honokiol-13C6. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
2-(4-hydroxy-3-prop-2-enyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-4-prop-2-enylphenol (CAS 1441417-34-0) is a chemical compound with the molecular formula C18H18O2 and a molecular weight of 272.29 g/mol. IUPAC name: 2-(4-hydroxy-3-prop-2-enyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-4-prop-2-enylphenol. InChIKey: FVYXIJYOAGAUQK-XZRQEUBQSA-N.
| Molecular formula | C18H18O2 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 2-(4-hydroxy-3-prop-2-enyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-4-prop-2-enylphenol |
| InChIKey | FVYXIJYOAGAUQK-XZRQEUBQSA-N |
| SMILES | C=CCC1=CC(=C(C=C1)O)[13C]2=[13CH][13C](=[13C]([13CH]=[13CH]2)O)CC=C |
Computed by PubChem (NCBI)