CAS 144301-84-8 appears in our catalog under these names: Brivudine Impurity 24, Brivudine Impurity 14, Methyl 2-deoxy-a-L-ribofuranoside. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1g.
(2S,3R,5R)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol (CAS 144301-84-8) is a chemical compound with the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. IUPAC name: (2S,3R,5R)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol. InChIKey: NVGJZDFWPSOTHM-NGJCXOISSA-N.
| Molecular formula | C6H12O4 |
|---|---|
| Molecular weight | 148.16 g/mol |
| IUPAC name | (2S,3R,5R)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol |
| InChIKey | NVGJZDFWPSOTHM-NGJCXOISSA-N |
| SMILES | CO[C@H]1C[C@H]([C@@H](O1)CO)O |
Computed by PubChem (NCBI)