CAS 51255-17-5 appears in our catalog under these names: Decitabine Impurity 1 (alpha-Isomer), Methyl 2-deoxy-a-D-ribofuranoside. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 0,25g, 1g, 5g, 2g.
(2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol (CAS 51255-17-5) is a chemical compound with the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. IUPAC name: (2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol. InChIKey: NVGJZDFWPSOTHM-JKUQZMGJSA-N.
| Molecular formula | C6H12O4 |
|---|---|
| Molecular weight | 148.16 g/mol |
| IUPAC name | (2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol |
| InChIKey | NVGJZDFWPSOTHM-JKUQZMGJSA-N |
| SMILES | CO[C@@H]1C[C@@H]([C@H](O1)CO)O |
Computed by PubChem (NCBI)