CAS 302349-32-2 is the registry number for Methyl 2-deoxy-L-threo-pentofuranoside. Offered by: Biosynth. Available pack sizes: 10g.
(2S,3S)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol (CAS 302349-32-2) is a chemical compound with the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. IUPAC name: (2S,3S)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol. InChIKey: NVGJZDFWPSOTHM-HVYQYDHPSA-N.
| Molecular formula | C6H12O4 |
|---|---|
| Molecular weight | 148.16 g/mol |
| IUPAC name | (2S,3S)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol |
| InChIKey | NVGJZDFWPSOTHM-HVYQYDHPSA-N |
| SMILES | COC1C[C@@H]([C@@H](O1)CO)O |
Computed by PubChem (NCBI)