CAS 51255-18-6 is the registry number for Methyl 2-deoxy-b-D-ribofuranoside. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 5g, 2g.
(2R,3S,5R)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol (CAS 51255-18-6) is a chemical compound with the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. IUPAC name: (2R,3S,5R)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol. InChIKey: NVGJZDFWPSOTHM-KVQBGUIXSA-N.
| Molecular formula | C6H12O4 |
|---|---|
| Molecular weight | 148.16 g/mol |
| IUPAC name | (2R,3S,5R)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol |
| InChIKey | NVGJZDFWPSOTHM-KVQBGUIXSA-N |
| SMILES | CO[C@H]1C[C@@H]([C@H](O1)CO)O |
Computed by PubChem (NCBI)