Products 1443110-13-1
CAS 1443110-13-1 appears in our catalog under these names: 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one, 95%, 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg.
8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one (CAS 1443110-13-1) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one. InChIKey: FBIZQRRTHLGXRW-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one |
| InChIKey | FBIZQRRTHLGXRW-UHFFFAOYSA-N |
| SMILES | CN1CCOC2=C(C1=O)C=CC(=C2)Br |
Computed by PubChem (NCBI)