Products 1443112-27-3
CAS 1443112-27-3 appears in our catalog under these names: (2-Cyano-6-methylpyridin-4-yl)boronic acid, 95%, 2–Methyl–6–cyanopyridine–4–boronic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 1g, 250mg, 5g, 25mg, 5mg.
(2-cyano-6-methyl-4-pyridinyl)boronic acid (CAS 1443112-27-3) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: (2-cyano-6-methyl-4-pyridinyl)boronic acid. InChIKey: RBACPNONJJGPIS-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | (2-cyano-6-methyl-4-pyridinyl)boronic acid |
| InChIKey | RBACPNONJJGPIS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)C#N)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-cyano-6-methyl-4-pyridyl)boronic acid