CAS 1443278-90-7 is the registry number for 4-((2,3-Dimethylphenyl)methoxy)-3-methoxybenzaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[(2,3-dimethylphenyl)methoxy]-3-methoxybenzaldehyde (CAS 1443278-90-7) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 4-[(2,3-dimethylphenyl)methoxy]-3-methoxybenzaldehyde. InChIKey: QWGGBXQABWWPAF-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 4-[(2,3-dimethylphenyl)methoxy]-3-methoxybenzaldehyde |
| InChIKey | QWGGBXQABWWPAF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)COC2=C(C=C(C=C2)C=O)OC)C |
Computed by PubChem (NCBI)