CAS 1443289-79-9 is the registry number for 1-(3-Fluorophenyl)-1H-1,2,3-triazol-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-fluorophenyl)triazol-4-amine (CAS 1443289-79-9) is a chemical compound with the molecular formula C8H7FN4 and a molecular weight of 178.17 g/mol. IUPAC name: 1-(3-fluorophenyl)triazol-4-amine. InChIKey: QAXQEJCLLAWAEK-UHFFFAOYSA-N.
| Molecular formula | C8H7FN4 |
|---|---|
| Molecular weight | 178.17 g/mol |
| IUPAC name | 1-(3-fluorophenyl)triazol-4-amine |
| InChIKey | QAXQEJCLLAWAEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)N2C=C(N=N2)N |
Computed by PubChem (NCBI)