CAS 168893-35-4 appears in our catalog under these names: 5-(4-Fluorophenyl)-4h-1,2,4-triazol-3-amine, 95%, 5-(4-Fluorophenyl)-4H-1,2,4-triazol-3-amine 95%, 5-(4-Fluorophenyl)-4H-1,2,4-triazol-3-amine, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine (CAS 168893-35-4) is a chemical compound with the molecular formula C8H7FN4 and a molecular weight of 178.17 g/mol. IUPAC name: 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: NPXAOQLRLGISLR-UHFFFAOYSA-N.
| Molecular formula | C8H7FN4 |
|---|---|
| Molecular weight | 178.17 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | NPXAOQLRLGISLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NN2)N)F |
Computed by PubChem (NCBI)