CAS 502685-67-8 appears in our catalog under these names: 5-(3-Fluorophenyl)-4h-1,2,4-triazol-3-amine, 95%, 5-(3-fluorophenyl)-4H-1,2,4-triazol-3-amine, 5-(3-Fluorophenyl)-4H-1,2,4-triazol-3-amine, 95%, 95%. Offered by: Combi-blocks, TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 50mg, 5g, 10g, 25g.
5-(3-fluorophenyl)-1H-1,2,4-triazol-3-amine (CAS 502685-67-8) is a chemical compound with the molecular formula C8H7FN4 and a molecular weight of 178.17 g/mol. IUPAC name: 5-(3-fluorophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: MDZOXXNHEDMHEZ-UHFFFAOYSA-N.
| Molecular formula | C8H7FN4 |
|---|---|
| Molecular weight | 178.17 g/mol |
| IUPAC name | 5-(3-fluorophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | MDZOXXNHEDMHEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC(=NN2)N |
Computed by PubChem (NCBI)