CAS 869942-02-9 is the registry number for 5-Fluoro-2-(1H-1,2,4-triazol-1-yl)aniline. Offered by: Biosynth. Available pack sizes: 10g.
5-fluoro-2-(1,2,4-triazol-1-yl)aniline (CAS 869942-02-9) is a chemical compound with the molecular formula C8H7FN4 and a molecular weight of 178.17 g/mol. IUPAC name: 5-fluoro-2-(1,2,4-triazol-1-yl)aniline. InChIKey: DJOJGYWPJKAVTO-UHFFFAOYSA-N.
| Molecular formula | C8H7FN4 |
|---|---|
| Molecular weight | 178.17 g/mol |
| IUPAC name | 5-fluoro-2-(1,2,4-triazol-1-yl)aniline |
| InChIKey | DJOJGYWPJKAVTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)N)N2C=NC=N2 |
Computed by PubChem (NCBI)