CAS 313662-92-9 appears in our catalog under these names: 5-(2-Fluorophenyl)-4h-1,2,4-triazol-3-amine, 95%, 5-(2-Fluorophenyl)-4H-1,2,4-triazol-3-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-(2-fluorophenyl)-1H-1,2,4-triazol-3-amine (CAS 313662-92-9) is a chemical compound with the molecular formula C8H7FN4 and a molecular weight of 178.17 g/mol. IUPAC name: 5-(2-fluorophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: PFTYWMOSGGHMSR-UHFFFAOYSA-N.
| Molecular formula | C8H7FN4 |
|---|---|
| Molecular weight | 178.17 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | PFTYWMOSGGHMSR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NN2)N)F |
Computed by PubChem (NCBI)