Products 1443314-22-4
CAS 1443314-22-4 is the registry number for 1-(4-Ethoxy-2-methylphenyl)-2,2,2-trifluoroethanone, ≥95%. Offered by: Chemat. Available pack sizes: 250mg.
1-(4-ethoxy-2-methylphenyl)-2,2,2-trifluoroethanone (CAS 1443314-22-4) is a chemical compound with the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. IUPAC name: 1-(4-ethoxy-2-methylphenyl)-2,2,2-trifluoroethanone. InChIKey: VSFUIEAEJAONQC-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O2 |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | 1-(4-ethoxy-2-methylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | VSFUIEAEJAONQC-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)C(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)