Products 1443424-59-6
CAS 1443424-59-6 is the registry number for 1-{5H,6H,7H,8H-(1,2,4)Triazolo(4,3-a)pyridin-3-yl}methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethanamine;dihydrochloride (CAS 1443424-59-6) is a chemical compound with the molecular formula C7H14Cl2N4 and a molecular weight of 225.12 g/mol. IUPAC name: 5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethanamine;dihydrochloride. InChIKey: MXTPRJYAQUWPAG-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N4 |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethanamine;dihydrochloride |
| InChIKey | MXTPRJYAQUWPAG-UHFFFAOYSA-N |
| SMILES | C1CCN2C(=NN=C2CN)C1.Cl.Cl |
Computed by PubChem (NCBI)