Products 144345-38-0
CAS 144345-38-0 is the registry number for Di-tert-butyl (2S,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg.
Ditert-butyl (2S,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate (CAS 144345-38-0) is a chemical compound with the molecular formula C15H25NO5 and a molecular weight of 299.36 g/mol. IUPAC name: ditert-butyl (2S,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: DABCKYVCUIIEGB-UWVGGRQHSA-N.
| Molecular formula | C15H25NO5 |
|---|---|
| Molecular weight | 299.36 g/mol |
| IUPAC name | ditert-butyl (2S,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | DABCKYVCUIIEGB-UWVGGRQHSA-N |
| SMILES | C[C@H]1C[C@H](N(C1=O)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)