CAS 1443618-57-2 is the registry number for (2R,4S)-2-(2,5-Difluorophenyl)-4-fluoropyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidine (CAS 1443618-57-2) is a chemical compound with the molecular formula C10H10F3N and a molecular weight of 201.19 g/mol. IUPAC name: (2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidine. InChIKey: SMQYQMQTCFRHEJ-OIBJUYFYSA-N.
| Molecular formula | C10H10F3N |
|---|---|
| Molecular weight | 201.19 g/mol |
| IUPAC name | (2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidine |
| InChIKey | SMQYQMQTCFRHEJ-OIBJUYFYSA-N |
| SMILES | C1[C@@H](CN[C@H]1C2=C(C=CC(=C2)F)F)F |
Computed by PubChem (NCBI)