CAS 1443684-70-5 is the registry number for 2-Chloro-6-fluorophenyl triflate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2-chloro-6-fluorophenyl) trifluoromethanesulfonate (CAS 1443684-70-5) is a chemical compound with the molecular formula C7H3ClF4O3S and a molecular weight of 278.61 g/mol. IUPAC name: (2-chloro-6-fluorophenyl) trifluoromethanesulfonate. InChIKey: PJRCZVCEJOPHIY-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O3S |
|---|---|
| Molecular weight | 278.61 g/mol |
| IUPAC name | (2-chloro-6-fluorophenyl) trifluoromethanesulfonate |
| InChIKey | PJRCZVCEJOPHIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OS(=O)(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)