CAS 40586-69-4 appears in our catalog under these names: 2,3,5,6–Tetrafluoro–4–methoxybenzenesulfonylchloride, 2,3,5,6-Tetrafluoro-4-methoxybenzenesulfonylchloride 95%, 2,3,5,6-Tetrafluoro-4-methoxybenzenesulfonylchloride, 95%, 2,3,5,6-TETRAFLUORO-4-METHOXYBENZENESULFONYL CHLORIDE, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,3,5,6-tetrafluoro-4-methoxybenzenesulfonyl chloride (CAS 40586-69-4) is a chemical compound with the molecular formula C7H3ClF4O3S and a molecular weight of 278.61 g/mol. IUPAC name: 2,3,5,6-tetrafluoro-4-methoxybenzenesulfonyl chloride. InChIKey: BHLCFDPXMFGGOH-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O3S |
|---|---|
| Molecular weight | 278.61 g/mol |
| IUPAC name | 2,3,5,6-tetrafluoro-4-methoxybenzenesulfonyl chloride |
| InChIKey | BHLCFDPXMFGGOH-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1F)F)S(=O)(=O)Cl)F)F |
Computed by PubChem (NCBI)