CAS 198206-02-9 is the registry number for 2-Chloro-4-fluorophenyl trifluoromethanesulfonate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
(2-chloro-4-fluorophenyl) trifluoromethanesulfonate (CAS 198206-02-9) is a chemical compound with the molecular formula C7H3ClF4O3S and a molecular weight of 278.61 g/mol. IUPAC name: (2-chloro-4-fluorophenyl) trifluoromethanesulfonate. InChIKey: KHMUKLPPUMOCFO-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O3S |
|---|---|
| Molecular weight | 278.61 g/mol |
| IUPAC name | (2-chloro-4-fluorophenyl) trifluoromethanesulfonate |
| InChIKey | KHMUKLPPUMOCFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)