Products 1803597-54-7
CAS 1803597-54-7 is the registry number for 2-Fluoro-3-(trifluoromethoxy)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-fluoro-3-(trifluoromethoxy)benzenesulfonyl chloride (CAS 1803597-54-7) is a chemical compound with the molecular formula C7H3ClF4O3S and a molecular weight of 278.61 g/mol. IUPAC name: 2-fluoro-3-(trifluoromethoxy)benzenesulfonyl chloride. InChIKey: FTLCZHMJLDXFPD-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O3S |
|---|---|
| Molecular weight | 278.61 g/mol |
| IUPAC name | 2-fluoro-3-(trifluoromethoxy)benzenesulfonyl chloride |
| InChIKey | FTLCZHMJLDXFPD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)S(=O)(=O)Cl)F)OC(F)(F)F |
Computed by PubChem (NCBI)