Products 2586111-78-4

CAS 2586111-78-4 is the registry number for 2,3,4,5-Tetrafluoro-6-methoxybenzenesulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,3,4,5-tetrafluoro-6-methoxybenzenesulfonyl chloride (CAS 2586111-78-4) is a chemical compound with the molecular formula C7H3ClF4O3S and a molecular weight of 278.61 g/mol. IUPAC name: 2,3,4,5-tetrafluoro-6-methoxybenzenesulfonyl chloride. InChIKey: ZSICSKGGZOWHQA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3ClF4O3S
Molecular weight278.61 g/mol
IUPAC name2,3,4,5-tetrafluoro-6-methoxybenzenesulfonyl chloride
InChIKeyZSICSKGGZOWHQA-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C(=C1S(=O)(=O)Cl)F)F)F)F

Computed by PubChem (NCBI)