CAS 2586111-78-4 is the registry number for 2,3,4,5-Tetrafluoro-6-methoxybenzenesulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,4,5-tetrafluoro-6-methoxybenzenesulfonyl chloride (CAS 2586111-78-4) is a chemical compound with the molecular formula C7H3ClF4O3S and a molecular weight of 278.61 g/mol. IUPAC name: 2,3,4,5-tetrafluoro-6-methoxybenzenesulfonyl chloride. InChIKey: ZSICSKGGZOWHQA-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O3S |
|---|---|
| Molecular weight | 278.61 g/mol |
| IUPAC name | 2,3,4,5-tetrafluoro-6-methoxybenzenesulfonyl chloride |
| InChIKey | ZSICSKGGZOWHQA-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1S(=O)(=O)Cl)F)F)F)F |
Computed by PubChem (NCBI)