CAS 1443978-74-2 appears in our catalog under these names: 2,5-Dimethyl-2h-1,2,6-thiadiazine-4-carboxylic acid 1,1-dioxide, 95%, 2,​5-​dimethyl-​2H-​1,​2,​6-​thiadiazine-​4-​carboxylic acid 1,​1-​dioxide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg.
2,5-dimethyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid (CAS 1443978-74-2) is a chemical compound with the molecular formula C6H8N2O4S and a molecular weight of 204.21 g/mol. IUPAC name: 2,5-dimethyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid. InChIKey: HPRDJZVMXWHMPW-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O4S |
|---|---|
| Molecular weight | 204.21 g/mol |
| IUPAC name | 2,5-dimethyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid |
| InChIKey | HPRDJZVMXWHMPW-UHFFFAOYSA-N |
| SMILES | CC1=NS(=O)(=O)N(C=C1C(=O)O)C |
Computed by PubChem (NCBI)