Products 1443978-74-2

CAS 1443978-74-2 appears in our catalog under these names: 2,5-Dimethyl-2h-1,2,6-thiadiazine-4-carboxylic acid 1,1-dioxide, 95%, 2,​5-​dimethyl-​2H-​1,​2,​6-​thiadiazine-​4-​carboxylic acid 1,​1-​dioxide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,5-dimethyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid (CAS 1443978-74-2) is a chemical compound with the molecular formula C6H8N2O4S and a molecular weight of 204.21 g/mol. IUPAC name: 2,5-dimethyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid. InChIKey: HPRDJZVMXWHMPW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8N2O4S
Molecular weight204.21 g/mol
IUPAC name2,5-dimethyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid
InChIKeyHPRDJZVMXWHMPW-UHFFFAOYSA-N
SMILESCC1=NS(=O)(=O)N(C=C1C(=O)O)C

Computed by PubChem (NCBI)