CAS 1482247-16-4 is the registry number for Methyl 4-sulfamoyl-1H-pyrrole-2-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 4-sulfamoyl-1H-pyrrole-2-carboxylate (CAS 1482247-16-4) is a chemical compound with the molecular formula C6H8N2O4S and a molecular weight of 204.21 g/mol. IUPAC name: methyl 4-sulfamoyl-1H-pyrrole-2-carboxylate. InChIKey: QRUUSDOCTACVLM-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O4S |
|---|---|
| Molecular weight | 204.21 g/mol |
| IUPAC name | methyl 4-sulfamoyl-1H-pyrrole-2-carboxylate |
| InChIKey | QRUUSDOCTACVLM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN1)S(=O)(=O)N |
Computed by PubChem (NCBI)