CAS 1547135-70-5 is the registry number for 1-Methyl-5-(methylsulfonyl)-1H-pyrazole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
1-methyl-5-methylsulfonylpyrazole-3-carboxylic acid (CAS 1547135-70-5) is a chemical compound with the molecular formula C6H8N2O4S and a molecular weight of 204.21 g/mol. IUPAC name: 1-methyl-5-methylsulfonylpyrazole-3-carboxylic acid. InChIKey: AEMYVNNPAZXPAH-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O4S |
|---|---|
| Molecular weight | 204.21 g/mol |
| IUPAC name | 1-methyl-5-methylsulfonylpyrazole-3-carboxylic acid |
| InChIKey | AEMYVNNPAZXPAH-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)