CAS 878218-38-3 appears in our catalog under these names: 4-(Aminosulfonyl)-1-methyl-1h-pyrrole-2-carboxylic acid, 95%, 1-Methyl-4-sulfamoyl-1H-pyrrole-2-carboxylic acid, 97%, 1-Methyl-4-sulfamoyl-1H-pyrrole-2-carboxylic acid, 4-(Aminosulfonyl)-1-methyl-1h-pyrrole-2-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g, 0,5g, 50mg.
1-methyl-4-sulfamoylpyrrole-2-carboxylic acid (CAS 878218-38-3) is a chemical compound with the molecular formula C6H8N2O4S and a molecular weight of 204.21 g/mol. IUPAC name: 1-methyl-4-sulfamoylpyrrole-2-carboxylic acid. InChIKey: NIXPJSDXYCVAQD-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O4S |
|---|---|
| Molecular weight | 204.21 g/mol |
| IUPAC name | 1-methyl-4-sulfamoylpyrrole-2-carboxylic acid |
| InChIKey | NIXPJSDXYCVAQD-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C1C(=O)O)S(=O)(=O)N |
Computed by PubChem (NCBI)