CAS 306936-62-9 appears in our catalog under these names: 5-(Aminosulphonyl)-1-methyl-1H-pyrrole-2-carboxylic Acid, 5-(Aminosulfonyl)-1-methyl-1H-pyrrole-2-carboxylic acid, 97% , 1-Methyl-5-sulfamoyl-1H-pyrrole-2-carboxylic acid, 98%. Offered by: TRC, Thermo Scientific, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
1-methyl-5-sulfamoylpyrrole-2-carboxylic acid (CAS 306936-62-9) is a chemical compound with the molecular formula C6H8N2O4S and a molecular weight of 204.21 g/mol. IUPAC name: 1-methyl-5-sulfamoylpyrrole-2-carboxylic acid. InChIKey: HIUOQXPHVZAOBG-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O4S |
|---|---|
| Molecular weight | 204.21 g/mol |
| IUPAC name | 1-methyl-5-sulfamoylpyrrole-2-carboxylic acid |
| InChIKey | HIUOQXPHVZAOBG-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=C1S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)