CAS 144398-46-9 is the registry number for 8-Demethoxyschinilenol. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[(2E,5E)-7-hydroxy-3,7-dimethylocta-2,5-dienoxy]chromen-2-one (CAS 144398-46-9) is a chemical compound with the molecular formula C19H22O4 and a molecular weight of 314.4 g/mol. IUPAC name: 7-[(2E,5E)-7-hydroxy-3,7-dimethylocta-2,5-dienoxy]chromen-2-one. InChIKey: ZHQPRJMIAALFHX-ATTWWORZSA-N.
| Molecular formula | C19H22O4 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 7-[(2E,5E)-7-hydroxy-3,7-dimethylocta-2,5-dienoxy]chromen-2-one |
| InChIKey | ZHQPRJMIAALFHX-ATTWWORZSA-N |
| SMILES | C/C(=C\COC1=CC2=C(C=C1)C=CC(=O)O2)/C/C=C/C(C)(C)O |
Computed by PubChem (NCBI)