CAS 1443981-23-4 appears in our catalog under these names: 2,6-Dimethyl-2,3-dihydro-1H-inden-1-amine hydrochloride, 2,6-dimethyl-2,3-dihydro-1H-inden-1-amine hydrochloride, Mixture of diastereomers, 95%, 95%, 2,6-Dimethyl-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
2,6-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1443981-23-4) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: 2,6-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: NNNCTWOOSYPXJE-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | 2,6-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | NNNCTWOOSYPXJE-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C1N)C=C(C=C2)C.Cl |
Computed by PubChem (NCBI)