CAS 730980-53-7 is the registry number for (1R,2S)-2,6-Dimethyl-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 730980-53-7) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: (1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: NNNCTWOOSYPXJE-IBYXRORRSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | (1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | NNNCTWOOSYPXJE-IBYXRORRSA-N |
| SMILES | C[C@H]1CC2=C([C@@H]1N)C=C(C=C2)C.Cl |
Computed by PubChem (NCBI)