CAS 1445086-83-8 appears in our catalog under these names: 1-(2,6-Difluorophenyl)-4-methoxy-2-methylbenzene, 95%, 1-(2,6-Difluorophenyl)-4-methoxy-2-methylbenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,3-difluoro-2-(4-methoxy-2-methylphenyl)benzene (CAS 1445086-83-8) is a chemical compound with the molecular formula C14H12F2O and a molecular weight of 234.24 g/mol. IUPAC name: 1,3-difluoro-2-(4-methoxy-2-methylphenyl)benzene. InChIKey: WBBYQMWKHGHRPJ-UHFFFAOYSA-N.
| Molecular formula | C14H12F2O |
|---|---|
| Molecular weight | 234.24 g/mol |
| IUPAC name | 1,3-difluoro-2-(4-methoxy-2-methylphenyl)benzene |
| InChIKey | WBBYQMWKHGHRPJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC)C2=C(C=CC=C2F)F |
Computed by PubChem (NCBI)