CAS 2918852-66-9 is the registry number for 1,3-difluoro-5-((4-methylbenzyl)oxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-difluoro-5-[(4-methylphenyl)methoxy]benzene (CAS 2918852-66-9) is a chemical compound with the molecular formula C14H12F2O and a molecular weight of 234.24 g/mol. IUPAC name: 1,3-difluoro-5-[(4-methylphenyl)methoxy]benzene. InChIKey: KVGKKKRPRXYZMV-UHFFFAOYSA-N.
| Molecular formula | C14H12F2O |
|---|---|
| Molecular weight | 234.24 g/mol |
| IUPAC name | 1,3-difluoro-5-[(4-methylphenyl)methoxy]benzene |
| InChIKey | KVGKKKRPRXYZMV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)COC2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)