Products 1889025-63-1
CAS 1889025-63-1 appears in our catalog under these names: 2–((1，1'–biphenyl)–4–yl)–2，2–difluoroethan–1–ol, 2,2-difluoro-2-(4-phenylphenyl)ethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
2,2-difluoro-2-(4-phenylphenyl)ethanol (CAS 1889025-63-1) is a chemical compound with the molecular formula C14H12F2O and a molecular weight of 234.24 g/mol. IUPAC name: 2,2-difluoro-2-(4-phenylphenyl)ethanol. InChIKey: FOSZXTQIMQFXBG-UHFFFAOYSA-N.
| Molecular formula | C14H12F2O |
|---|---|
| Molecular weight | 234.24 g/mol |
| IUPAC name | 2,2-difluoro-2-(4-phenylphenyl)ethanol |
| InChIKey | FOSZXTQIMQFXBG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(CO)(F)F |
Computed by PubChem (NCBI)