CAS 2432848-50-3 is the registry number for 1,2-Difluoro-4-(4-methoxybenzyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
1,2-difluoro-4-[(4-methoxyphenyl)methyl]benzene (CAS 2432848-50-3) is a chemical compound with the molecular formula C14H12F2O and a molecular weight of 234.24 g/mol. IUPAC name: 1,2-difluoro-4-[(4-methoxyphenyl)methyl]benzene. InChIKey: HSYOKIQEZKBATE-UHFFFAOYSA-N.
| Molecular formula | C14H12F2O |
|---|---|
| Molecular weight | 234.24 g/mol |
| IUPAC name | 1,2-difluoro-4-[(4-methoxyphenyl)methyl]benzene |
| InChIKey | HSYOKIQEZKBATE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)