CAS 842140-58-3 is the registry number for 3,5-Difluoro-α-(4-methylphenyl)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3,5-difluorophenyl)-(4-methylphenyl)methanol (CAS 842140-58-3) is a chemical compound with the molecular formula C14H12F2O and a molecular weight of 234.24 g/mol. IUPAC name: (3,5-difluorophenyl)-(4-methylphenyl)methanol. InChIKey: KSGPZFYNIZMPSJ-UHFFFAOYSA-N.
| Molecular formula | C14H12F2O |
|---|---|
| Molecular weight | 234.24 g/mol |
| IUPAC name | (3,5-difluorophenyl)-(4-methylphenyl)methanol |
| InChIKey | KSGPZFYNIZMPSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC(=CC(=C2)F)F)O |
Computed by PubChem (NCBI)