CAS 1445995-75-4 appears in our catalog under these names: 2'-Hydroxy-2,2,2,6'-tetrafluoroacetophenone, 95%, 2,2,2-Trifluoro-1-(2-fluoro-6-hydroxyphenyl)ethanone, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2,2,2-trifluoro-1-(2-fluoro-6-hydroxyphenyl)ethanone (CAS 1445995-75-4) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2-fluoro-6-hydroxyphenyl)ethanone. InChIKey: KSFNFJLUGOPZQK-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2-fluoro-6-hydroxyphenyl)ethanone |
| InChIKey | KSFNFJLUGOPZQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)C(F)(F)F)O |
Computed by PubChem (NCBI)