CAS 14461-92-8 appears in our catalog under these names: LD 4202, N–methyl Cyclazodone, 2-(Cyclopropyl(methyl)amino)-5-phenyloxazol-4(5H)-one. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 5 mg, 1 mg.
2-[cyclopropyl(methyl)amino]-5-phenyl-1,3-oxazol-4-one (CAS 14461-92-8) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: 2-[cyclopropyl(methyl)amino]-5-phenyl-1,3-oxazol-4-one. InChIKey: FFWGGFGJVZVGOW-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 2-[cyclopropyl(methyl)amino]-5-phenyl-1,3-oxazol-4-one |
| InChIKey | FFWGGFGJVZVGOW-UHFFFAOYSA-N |
| SMILES | CN(C1CC1)C2=NC(=O)C(O2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)