CAS 1446182-61-1 is the registry number for 2-Amino-3,5-dibromoisonicotinonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-3,5-dibromopyridine-4-carbonitrile (CAS 1446182-61-1) is a chemical compound with the molecular formula C6H3Br2N3 and a molecular weight of 276.92 g/mol. IUPAC name: 2-amino-3,5-dibromopyridine-4-carbonitrile. InChIKey: KGGDRNMWKSOQCB-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2N3 |
|---|---|
| Molecular weight | 276.92 g/mol |
| IUPAC name | 2-amino-3,5-dibromopyridine-4-carbonitrile |
| InChIKey | KGGDRNMWKSOQCB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)N)Br)C#N)Br |
Computed by PubChem (NCBI)