Products 1446334-78-6
CAS 1446334-78-6 is the registry number for (2-Methylimidazo[1,2-a]pyridin-6-yl)boronic acid, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-methylimidazo[1,2-a]pyridin-6-yl)boronic acid (CAS 1446334-78-6) is a chemical compound with the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. IUPAC name: (2-methylimidazo[1,2-a]pyridin-6-yl)boronic acid. InChIKey: VUUPLVFPKSXZMN-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O2 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (2-methylimidazo[1,2-a]pyridin-6-yl)boronic acid |
| InChIKey | VUUPLVFPKSXZMN-UHFFFAOYSA-N |
| SMILES | B(C1=CN2C=C(N=C2C=C1)C)(O)O |
Computed by PubChem (NCBI)