CAS 1446411-57-9 is the registry number for 3-(2-Chlorophenoxy)propan-1-amine Hydrochloride. Offered by: TRC. Available pack sizes: 5g.
3-(2-chlorophenoxy)propan-1-amine;hydrochloride (CAS 1446411-57-9) is a chemical compound with the molecular formula C9H13Cl2NO and a molecular weight of 222.11 g/mol. IUPAC name: 3-(2-chlorophenoxy)propan-1-amine;hydrochloride. InChIKey: JFTGICJDONDVJY-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NO |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | 3-(2-chlorophenoxy)propan-1-amine;hydrochloride |
| InChIKey | JFTGICJDONDVJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCCCN)Cl.Cl |
Computed by PubChem (NCBI)