Products 1446971-41-0
CAS 1446971-41-0 is the registry number for ZLc-002. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl (2R)-2-[(3-methoxy-3-oxopropanoyl)amino]-3-methylbutanoate (CAS 1446971-41-0) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: methyl (2R)-2-[(3-methoxy-3-oxopropanoyl)amino]-3-methylbutanoate. InChIKey: BWPKYDAJBOUZDX-SECBINFHSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | methyl (2R)-2-[(3-methoxy-3-oxopropanoyl)amino]-3-methylbutanoate |
| InChIKey | BWPKYDAJBOUZDX-SECBINFHSA-N |
| SMILES | CC(C)[C@H](C(=O)OC)NC(=O)CC(=O)OC |
Computed by PubChem (NCBI)