Products 1447457-27-3
CAS 1447457-27-3 appears in our catalog under these names: (5S,8R)-5,7,8,9-Tetrahydro-1,5,8-trimethylnaphtho[2,1-b]furan-6(4H)-one, ≥98%, ≥98%, Agarsenone. Offered by: Chemat, MedChemExpress. Available pack sizes: 20mg, 50mg, 100mg, Get quote.
(5S,8R)-1,5,8-trimethyl-5,7,8,9-tetrahydro-4H-benzo[e][1]benzofuran-6-one (CAS 1447457-27-3) is a chemical compound with the molecular formula C15H18O2 and a molecular weight of 230.30 g/mol. IUPAC name: (5S,8R)-1,5,8-trimethyl-5,7,8,9-tetrahydro-4H-benzo[e][1]benzofuran-6-one. InChIKey: ZYFISEHWAGWCRY-BDAKNGLRSA-N.
| Molecular formula | C15H18O2 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | (5S,8R)-1,5,8-trimethyl-5,7,8,9-tetrahydro-4H-benzo[e][1]benzofuran-6-one |
| InChIKey | ZYFISEHWAGWCRY-BDAKNGLRSA-N |
| SMILES | C[C@@H]1CC2=C([C@H](CC3=C2C(=CO3)C)C)C(=O)C1 |
Computed by PubChem (NCBI)