CAS 1448230-55-4 appears in our catalog under these names: 8-Bromo-4,5-Dimethylquinoline, 97%(GC-MS),RG, 97%(GC-MS),RG, 8-Bromo-4,5-dimethylquinoline, 97%,RG. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
8-bromo-4,5-dimethylquinoline (CAS 1448230-55-4) is a chemical compound with the molecular formula C11H10BrN and a molecular weight of 236.11 g/mol. IUPAC name: 8-bromo-4,5-dimethylquinoline. InChIKey: MAYNASLULYRPOY-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN |
|---|---|
| Molecular weight | 236.11 g/mol |
| IUPAC name | 8-bromo-4,5-dimethylquinoline |
| InChIKey | MAYNASLULYRPOY-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=NC2=C(C=C1)Br)C |
Computed by PubChem (NCBI)