Products 1448348-02-4

CAS 1448348-02-4 is the registry number for (S)-1-(tert-Butyl) 3-methyl 5-oxopiperazine-1,3-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O-methyl (3S)-5-oxopiperazine-1,3-dicarboxylate (CAS 1448348-02-4) is a chemical compound with the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S)-5-oxopiperazine-1,3-dicarboxylate. InChIKey: FQTDIZOVFWSTBE-ZETCQYMHSA-N.

Identity
Molecular formulaC11H18N2O5
Molecular weight258.27 g/mol
IUPAC name1-O-tert-butyl 3-O-methyl (3S)-5-oxopiperazine-1,3-dicarboxylate
InChIKeyFQTDIZOVFWSTBE-ZETCQYMHSA-N
SMILESCC(C)(C)OC(=O)N1C[C@H](NC(=O)C1)C(=O)OC

Computed by PubChem (NCBI)