CAS 144838-82-4 appears in our catalog under these names: (R)-4-Benzyl-3-(2-phenylacetyl)oxazolidin-2-one, 95%, (4R)-4-Benzyl-3-(phenylacetyl)-1,3-oxazolidin-2-one. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g.
(4R)-4-benzyl-3-(2-phenylacetyl)-1,3-oxazolidin-2-one (CAS 144838-82-4) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: (4R)-4-benzyl-3-(2-phenylacetyl)-1,3-oxazolidin-2-one. InChIKey: AQFHLFHMTNGCPQ-MRXNPFEDSA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | (4R)-4-benzyl-3-(2-phenylacetyl)-1,3-oxazolidin-2-one |
| InChIKey | AQFHLFHMTNGCPQ-MRXNPFEDSA-N |
| SMILES | C1[C@H](N(C(=O)O1)C(=O)CC2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)