Products 1448667-05-7
CAS 1448667-05-7 is the registry number for Alpiniaterpene A. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
(2R)-2-[(1R,4aS,8aS)-7-methoxycarbonyl-4-methylidene-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]propanoic acid (CAS 1448667-05-7) is a chemical compound with the molecular formula C16H22O4 and a molecular weight of 278.34 g/mol. IUPAC name: (2R)-2-[(1R,4aS,8aS)-7-methoxycarbonyl-4-methylidene-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]propanoic acid. InChIKey: QSWDROZZIFWYRS-ZZVYKPCYSA-N.
| Molecular formula | C16H22O4 |
|---|---|
| Molecular weight | 278.34 g/mol |
| IUPAC name | (2R)-2-[(1R,4aS,8aS)-7-methoxycarbonyl-4-methylidene-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]propanoic acid |
| InChIKey | QSWDROZZIFWYRS-ZZVYKPCYSA-N |
| SMILES | C[C@H]([C@@H]1CCC(=C)[C@@H]2[C@@H]1C=C(CC2)C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Alpiniaterpene A, orb1683179