Products 1448673-25-3
CAS 1448673-25-3 is the registry number for 2-[2-(4-Aminophenoxy)ethoxy]-1h-isoindole-1,3(2h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[2-(4-aminophenoxy)ethoxy]isoindole-1,3-dione (CAS 1448673-25-3) is a chemical compound with the molecular formula C16H14N2O4 and a molecular weight of 298.29 g/mol. IUPAC name: 2-[2-(4-aminophenoxy)ethoxy]isoindole-1,3-dione. InChIKey: DBTRPVCSUVWNKQ-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O4 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | 2-[2-(4-aminophenoxy)ethoxy]isoindole-1,3-dione |
| InChIKey | DBTRPVCSUVWNKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OCCOC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)