CAS 5320-91-2 appears in our catalog under these names: Azobenzene-4,4'-dicarboxylic acid dimethyl ester, 95%, Dimethyl Azobenzene–4,4'–dicarboxylate, Dimethyl Azobenzene-4,4'-dicarboxylate, >95.0%(GC), Azobenzene-4,4'-dicarboxylic acid dimethyl ester, DIMETHYL AZOBENZENE-4,4'-DICARBOXYLATE, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 200mg.
Methyl 4-[(4-methoxycarbonylphenyl)diazenyl]benzoate (CAS 5320-91-2) is a chemical compound with the molecular formula C16H14N2O4 and a molecular weight of 298.29 g/mol. IUPAC name: methyl 4-[(4-methoxycarbonylphenyl)diazenyl]benzoate. InChIKey: PSNNNVCIKCUWKM-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O4 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | methyl 4-[(4-methoxycarbonylphenyl)diazenyl]benzoate |
| InChIKey | PSNNNVCIKCUWKM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)