CAS 1609403-19-1 is the registry number for (1-Oxo-4-phenyl-2(1h)-phthalazinyl)acetic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
2-(1-oxo-4-phenylphthalazin-2-yl)acetic acid;hydrate (CAS 1609403-19-1) is a chemical compound with the molecular formula C16H14N2O4 and a molecular weight of 298.29 g/mol. IUPAC name: 2-(1-oxo-4-phenylphthalazin-2-yl)acetic acid;hydrate. InChIKey: GNLCUQJDECARTP-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O4 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | 2-(1-oxo-4-phenylphthalazin-2-yl)acetic acid;hydrate |
| InChIKey | GNLCUQJDECARTP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C(=O)C3=CC=CC=C32)CC(=O)O.O |
Computed by PubChem (NCBI)